C23H22N4O3 — CID 53181949
3-cyano-N-[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]cyclohexyl]benzamide (PubChem CID 53181949) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 3-cyano-N-[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]cyclohexyl]benzamide.
| Compound Name | 3-cyano-N-[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 53181949 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-cyano-N-[1-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]cyclohexyl]benzamide |
| SMILES | COc1ccc(-c2noc(C3(NC(=O)c4cccc(C#N)c4)CCCCC3)n2)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-29-19-10-8-17(9-11-19)20-25-22(30-27-20)23(12-3-2-4-13-23)26-21(28)18-7-5-6-16(14-18)15-24/h5-11,14H,2-4,12-13H2,1H3,(H,26,28) |
| InChIKey | NRANSDRWZYFOLF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |