C15H16N2O4 — CID 91650435
methyl 3-[5-(1-hydroxycyclopentyl)-1,2,4-oxadiazol-3-yl]benzoate (PubChem CID 91650435) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 3-[5-(1-hydroxycyclopentyl)-1,2,4-oxadiazol-3-yl]benzoate.
| Compound Name | methyl 3-[5-(1-hydroxycyclopentyl)-1,2,4-oxadiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 91650435 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | methyl 3-[5-(1-hydroxycyclopentyl)-1,2,4-oxadiazol-3-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2noc(C3(O)CCCC3)n2)c1 |
| InChI | InChI=1S/C15H16N2O4/c1-20-13(18)11-6-4-5-10(9-11)12-16-14(21-17-12)15(19)7-2-3-8-15/h4-6,9,19H,2-3,7-8H2,1H3 |
| InChIKey | GJCGKDHLACWOOU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |