C14H14N2O3S — CID 81452965
3-[5-(2-methylthiolan-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 81452965) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is 3-[5-(2-methylthiolan-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid.
| Compound Name | 3-[5-(2-methylthiolan-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 81452965 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[5-(2-methylthiolan-2-yl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| SMILES | CC1(c2nc(-c3cccc(C(=O)O)c3)no2)CCCS1 |
| InChI | InChI=1S/C14H14N2O3S/c1-14(6-3-7-20-14)13-15-11(16-19-13)9-4-2-5-10(8-9)12(17)18/h2,4-5,8H,3,6-7H2,1H3,(H,17,18) |
| InChIKey | AWMUPIMTJPTSJC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |