About methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate
methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate (PubChem CID 101483431) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate.
Molecular Properties
| Compound Name | methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate |
| PubChem CID | 101483431 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2c(C)noc2C)c1 |
| InChI | InChI=1S/C13H13NO3/c1-8-12(9(2)17-14-8)10-5-4-6-11(7-10)13(15)16-3/h4-7H,1-3H3 |
| InChIKey | PVADSZLPKGGLAC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
The IUPAC name of methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate (CID 101483431) is methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate.
What is the SMILES notation for methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
The canonical SMILES for methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate is COC(=O)c1cccc(-c2c(C)noc2C)c1.
What is the InChIKey of methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
The InChIKey is PVADSZLPKGGLAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-8-12(9(2)17-14-8)10-5-4-6-11(7-10)13(15)16-3/h4-7H,1-3H3.
What are the key properties of methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate?
methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate has a molecular weight of 231.25 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzoate is sourced from PubChem (CID 101483431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).