C19H19N3O3 — CID 167061902
methyl 4-[2-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]benzoate (PubChem CID 167061902) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 4-[2-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]benzoate.
| Compound Name | methyl 4-[2-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]benzoate |
|---|---|
| PubChem CID | 167061902 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | methyl 4-[2-amino-5-(3,5-dimethyl-1,2-oxazol-4-yl)anilino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2cc(-c3c(C)noc3C)ccc2N)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-11-18(12(2)25-22-11)14-6-9-16(20)17(10-14)21-15-7-4-13(5-8-15)19(23)24-3/h4-10,21H,20H2,1-3H3 |
| InChIKey | WEUFMYMRCXZBLK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|