About methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate
methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate (PubChem CID 167061903) has the molecular formula C20H17N3O4
and a molecular weight of 363.37 g/mol. Its IUPAC name is methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate |
| PubChem CID | 167061903 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(=O)[nH]c3ccc(-c4c(C)noc4C)cc32)cc1 |
| InChI | InChI=1S/C20H17N3O4/c1-11-18(12(2)27-22-11)14-6-9-16-17(10-14)23(20(25)21-16)15-7-4-13(5-8-15)19(24)26-3/h4-10H,1-3H3,(H,21,25) |
| InChIKey | XWZFUVYMYXCSEM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate?
The IUPAC name of methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate (CID 167061903) is methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate.
What is the SMILES notation for methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate?
The canonical SMILES for methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate is COC(=O)c1ccc(-n2c(=O)[nH]c3ccc(-c4c(C)noc4C)cc32)cc1.
What is the InChIKey of methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate?
The InChIKey is XWZFUVYMYXCSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O4/c1-11-18(12(2)27-22-11)14-6-9-16-17(10-14)23(20(25)21-16)15-7-4-13(5-8-15)19(24)26-3/h4-10H,1-3H3,(H,21,25).
What are the key properties of methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate?
methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate has a molecular weight of 363.37 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-3H-benzimidazol-1-yl]benzoate is sourced from PubChem (CID 167061903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).