C26H27N3O3 — CID 118059458
methyl 4-[1-(cyclopentylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]benzoate (PubChem CID 118059458) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 4-[1-(cyclopentylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]benzoate.
| Compound Name | methyl 4-[1-(cyclopentylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]benzoate |
|---|---|
| PubChem CID | 118059458 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | methyl 4-[1-(cyclopentylmethyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cn(CC3CCCC3)c3cc(-c4c(C)noc4C)cnc23)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-16-24(17(2)32-28-16)21-12-23-25(27-13-21)22(15-29(23)14-18-6-4-5-7-18)19-8-10-20(11-9-19)26(30)31-3/h8-13,15,18H,4-7,14H2,1-3H3 |
| InChIKey | LRROTZOIGNXGCP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|