C26H28N4O3 — CID 135295078
4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzamide (PubChem CID 135295078) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzamide.
| Compound Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 135295078 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzamide |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3ccc(C(N)=O)cc3)cn(CC3(C)CCOCC3)c2c1 |
| InChI | InChI=1S/C26H28N4O3/c1-16-23(17(2)33-29-16)20-12-22-24(28-13-20)21(18-4-6-19(7-5-18)25(27)31)14-30(22)15-26(3)8-10-32-11-9-26/h4-7,12-14H,8-11,15H2,1-3H3,(H2,27,31) |
| InChIKey | KHSCNJUOGXMFBA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|