C28H31N3O2 — CID 135294888
4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]indol-3-yl]benzamide (PubChem CID 135294888) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]indol-3-yl]benzamide.
| Compound Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]indol-3-yl]benzamide |
|---|---|
| PubChem CID | 135294888 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(1-methylcyclohexyl)methyl]indol-3-yl]benzamide |
| SMILES | Cc1noc(C)c1-c1ccc2c(-c3ccc(C(N)=O)cc3)cn(CC3(C)CCCCC3)c2c1 |
| InChI | InChI=1S/C28H31N3O2/c1-18-26(19(2)33-30-18)22-11-12-23-24(20-7-9-21(10-8-20)27(29)32)16-31(25(23)15-22)17-28(3)13-5-4-6-14-28/h7-12,15-16H,4-6,13-14,17H2,1-3H3,(H2,29,32) |
| InChIKey | UNNGRLBBUTUZTB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|