C27H29N3O3 — CID 135294867
2-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]phenyl]acetaldehyde (PubChem CID 135294867) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]phenyl]acetaldehyde.
| Compound Name | 2-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 135294867 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(4-methyloxan-4-yl)methyl]pyrrolo[3,2-b]pyridin-3-yl]phenyl]acetaldehyde |
| SMILES | Cc1noc(C)c1-c1cnc2c(-c3ccc(CC=O)cc3)cn(CC3(C)CCOCC3)c2c1 |
| InChI | InChI=1S/C27H29N3O3/c1-18-25(19(2)33-29-18)22-14-24-26(28-15-22)23(21-6-4-20(5-7-21)8-11-31)16-30(24)17-27(3)9-12-32-13-10-27/h4-7,11,14-16H,8-10,12-13,17H2,1-3H3 |
| InChIKey | LREKEKOIQJEIGB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|