C25H26F2N4O — CID 135295005
5-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)indol-3-yl]pyridin-2-amine (PubChem CID 135295005) has the molecular formula C25H26F2N4O and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)indol-3-yl]pyridin-2-amine.
| Compound Name | 5-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)indol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 135295005 |
| Molecular Formula | C25H26F2N4O |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 5-[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)indol-3-yl]pyridin-2-amine |
| SMILES | Cc1noc(C)c1-c1ccc2c(-c3ccc(N)nc3)cn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C25H26F2N4O/c1-15-24(16(2)32-30-15)18-3-5-20-21(19-4-6-23(28)29-12-19)14-31(22(20)11-18)13-17-7-9-25(26,27)10-8-17/h3-6,11-12,14,17H,7-10,13H2,1-2H3,(H2,28,29) |
| InChIKey | RVGNZWCOMJYQKN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|