C31H32F2N2O — CID 144710244
4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[4-(1-ethenylcyclopropyl)phenyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 144710244) has the molecular formula C31H32F2N2O and a molecular weight of 486.61 g/mol. Its IUPAC name is 4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[4-(1-ethenylcyclopropyl)phenyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[4-(1-ethenylcyclopropyl)phenyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 144710244 |
| Molecular Formula | C31H32F2N2O |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 4-[1-[(4,4-difluorocyclohexyl)methyl]-3-[4-(1-ethenylcyclopropyl)phenyl]indol-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | C=CC1(c2ccc(-c3cn(CC4CCC(F)(F)CC4)c4cc(-c5c(C)noc5C)ccc34)cc2)CC1 |
| InChI | InChI=1S/C31H32F2N2O/c1-4-30(15-16-30)25-8-5-23(6-9-25)27-19-35(18-22-11-13-31(32,33)14-12-22)28-17-24(7-10-26(27)28)29-20(2)34-36-21(29)3/h4-10,17,19,22H,1,11-16,18H2,2-3H3 |
| InChIKey | KWSKKJXAPGNUOG-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|