C27H29N3O4 — CID 90449035
1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(oxan-4-ylmethyl)pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol (PubChem CID 90449035) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(oxan-4-ylmethyl)pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol.
| Compound Name | 1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(oxan-4-ylmethyl)pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol |
|---|---|
| PubChem CID | 90449035 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(oxan-4-ylmethyl)pyrrolo[3,2-b]pyridin-3-yl]-2-methoxyphenyl]ethenol |
| SMILES | C=C(O)c1ccc(-c2cn(CC3CCOCC3)c3cc(-c4c(C)noc4C)cnc23)cc1OC |
| InChI | InChI=1S/C27H29N3O4/c1-16-26(18(3)34-29-16)21-11-24-27(28-13-21)23(15-30(24)14-19-7-9-33-10-8-19)20-5-6-22(17(2)31)25(12-20)32-4/h5-6,11-13,15,19,31H,2,7-10,14H2,1,3-4H3 |
| InChIKey | GGCRNYOIJNETMN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|