C20H16ClF3N4O3 — CID 140850357
N-[2-chloro-1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide (PubChem CID 140850357) has the molecular formula C20H16ClF3N4O3 and a molecular weight of 452.82 g/mol. Its IUPAC name is N-[2-chloro-1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide.
| Compound Name | N-[2-chloro-1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140850357 |
| Molecular Formula | C20H16ClF3N4O3 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | N-[2-chloro-1-[3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]cyclopentyl]pyridine-3-carboxamide |
| SMILES | O=C(NC1(c2nc(-c3ccc(OC(F)(F)F)cc3)no2)CCCC1Cl)c1cccnc1 |
| InChI | InChI=1S/C20H16ClF3N4O3/c21-15-4-1-9-19(15,27-17(29)13-3-2-10-25-11-13)18-26-16(28-31-18)12-5-7-14(8-6-12)30-20(22,23)24/h2-3,5-8,10-11,15H,1,4,9H2,(H,27,29) |
| InChIKey | STXGBFLYKAGUNX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|