C24H25ClN2O3 — CID 68892824
2-[4-[4-[2-[3-(chloromethyl)anilino]-1,3-oxazol-5-yl]phenyl]cyclohexyl]acetic acid (PubChem CID 68892824) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is 2-[4-[4-[2-[3-(chloromethyl)anilino]-1,3-oxazol-5-yl]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[2-[3-(chloromethyl)anilino]-1,3-oxazol-5-yl]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 68892824 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[4-[4-[2-[3-(chloromethyl)anilino]-1,3-oxazol-5-yl]phenyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(c2ccc(-c3cnc(Nc4cccc(CCl)c4)o3)cc2)CC1 |
| InChI | InChI=1S/C24H25ClN2O3/c25-14-17-2-1-3-21(12-17)27-24-26-15-22(30-24)20-10-8-19(9-11-20)18-6-4-16(5-7-18)13-23(28)29/h1-3,8-12,15-16,18H,4-7,13-14H2,(H,26,27)(H,28,29) |
| InChIKey | DJUZWXSXQABXQD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|