C19H12F6N2O2 — CID 118828810
2,5-bis[3-(trifluoromethoxy)phenyl]pyridin-4-amine (PubChem CID 118828810) has the molecular formula C19H12F6N2O2 and a molecular weight of 414.31 g/mol. Its IUPAC name is 2,5-bis[3-(trifluoromethoxy)phenyl]pyridin-4-amine.
| Compound Name | 2,5-bis[3-(trifluoromethoxy)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 118828810 |
| Molecular Formula | C19H12F6N2O2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2,5-bis[3-(trifluoromethoxy)phenyl]pyridin-4-amine |
| SMILES | Nc1cc(-c2cccc(OC(F)(F)F)c2)ncc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F6N2O2/c20-18(21,22)28-13-5-1-3-11(7-13)15-10-27-17(9-16(15)26)12-4-2-6-14(8-12)29-19(23,24)25/h1-10H,(H2,26,27) |
| InChIKey | ZMDXWRSXMIYTTC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |