C21H13F6NO4 — CID 134634030
methyl 2,5-bis[3-(trifluoromethoxy)phenyl]pyridine-4-carboxylate (PubChem CID 134634030) has the molecular formula C21H13F6NO4 and a molecular weight of 457.33 g/mol. Its IUPAC name is methyl 2,5-bis[3-(trifluoromethoxy)phenyl]pyridine-4-carboxylate.
| Compound Name | methyl 2,5-bis[3-(trifluoromethoxy)phenyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134634030 |
| Molecular Formula | C21H13F6NO4 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | methyl 2,5-bis[3-(trifluoromethoxy)phenyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(OC(F)(F)F)c2)ncc1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C21H13F6NO4/c1-30-19(29)16-10-18(13-5-3-7-15(9-13)32-21(25,26)27)28-11-17(16)12-4-2-6-14(8-12)31-20(22,23)24/h2-11H,1H3 |
| InChIKey | XUIBSSFDMSAIPE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |