C15H8F3N3O — CID 136960287
9-(trifluoromethoxy)-1H-indolo[2,3-b][1,5]naphthyridine (PubChem CID 136960287) has the molecular formula C15H8F3N3O and a molecular weight of 303.24 g/mol. Its IUPAC name is 9-(trifluoromethoxy)-1H-indolo[2,3-b][1,5]naphthyridine.
| Compound Name | 9-(trifluoromethoxy)-1H-indolo[2,3-b][1,5]naphthyridine |
|---|---|
| PubChem CID | 136960287 |
| Molecular Formula | C15H8F3N3O |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 9-(trifluoromethoxy)-1H-indolo[2,3-b][1,5]naphthyridine |
| SMILES | FC(F)(F)Oc1ccc2nc3nc4ccc[nH]c4cc3c2c1 |
| InChI | InChI=1S/C15H8F3N3O/c16-15(17,18)22-8-3-4-11-9(6-8)10-7-13-12(2-1-5-19-13)21-14(10)20-11/h1-7,19H |
| InChIKey | ZLGKAMIJXQDXFE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |