C20H19NO4 — CID 3511446
6-ethoxy-2-(4-ethoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 3511446) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 6-ethoxy-2-(4-ethoxyphenyl)quinoline-4-carboxylic acid.
| Compound Name | 6-ethoxy-2-(4-ethoxyphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3511446 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-ethoxy-2-(4-ethoxyphenyl)quinoline-4-carboxylic acid |
| SMILES | CCOc1ccc(-c2cc(C(=O)O)c3cc(OCC)ccc3n2)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-3-24-14-7-5-13(6-8-14)19-12-17(20(22)23)16-11-15(25-4-2)9-10-18(16)21-19/h5-12H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | GYRWHIHMWOUEFX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |