C21H21NO4 — CID 3507309
2-(2,4-diethoxyphenyl)-6-methylquinoline-4-carboxylic acid (PubChem CID 3507309) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-(2,4-diethoxyphenyl)-6-methylquinoline-4-carboxylic acid.
| Compound Name | 2-(2,4-diethoxyphenyl)-6-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3507309 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-(2,4-diethoxyphenyl)-6-methylquinoline-4-carboxylic acid |
| SMILES | CCOc1ccc(-c2cc(C(=O)O)c3cc(C)ccc3n2)c(OCC)c1 |
| InChI | InChI=1S/C21H21NO4/c1-4-25-14-7-8-15(20(11-14)26-5-2)19-12-17(21(23)24)16-10-13(3)6-9-18(16)22-19/h6-12H,4-5H2,1-3H3,(H,23,24) |
| InChIKey | MWAMZESZVMUSQQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |