2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid

C20H19NO4 — CID 753136

IUPAC2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid
SMILESCCOc1ccc(-c2cc(C(=O)O)c3ccccc3n2)c(OCC)c1
InChIInChI=1S/C20H19NO4/c1-3-24-13-9-10-15(19(11-13)25-4-2)18-12-16(20(22)23)14-7-5-6-8-17(14)21-18/h5-12H,3-4H2,1-2H3,(H,22,23)
InChIKeyOPQKIVHATIKTHV-UHFFFAOYSA-N
MW337.38 g/mol
LogP4.40
Rot. Bonds6

About 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid

2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid (PubChem CID 753136) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid.

Molecular Properties

Compound Name2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid
PubChem CID753136
Molecular FormulaC20H19NO4
Molecular Weight337.38 g/mol
Exact Mass337.13
IUPAC Name2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid
SMILESCCOc1ccc(-c2cc(C(=O)O)c3ccccc3n2)c(OCC)c1
InChIInChI=1S/C20H19NO4/c1-3-24-13-9-10-15(19(11-13)25-4-2)18-12-16(20(22)23)14-7-5-6-8-17(14)21-18/h5-12H,3-4H2,1-2H3,(H,22,23)
InChIKeyOPQKIVHATIKTHV-UHFFFAOYSA-N
XLogP4.40
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.38
LogP ≤ 54.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The IUPAC name of 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid (CID 753136) is 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid.
What is the SMILES notation for 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The canonical SMILES for 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid is CCOc1ccc(-c2cc(C(=O)O)c3ccccc3n2)c(OCC)c1.
What is the InChIKey of 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
The InChIKey is OPQKIVHATIKTHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4/c1-3-24-13-9-10-15(19(11-13)25-4-2)18-12-16(20(22)23)14-7-5-6-8-17(14)21-18/h5-12H,3-4H2,1-2H3,(H,22,23).
What are the key properties of 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid?
2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid has a molecular weight of 337.38 g/mol, XLogP of 4.40, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diethoxyphenyl)quinoline-4-carboxylic acid is sourced from PubChem (CID 753136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).