C26H20F3NO3 — CID 153380378
2-[4-(4-propoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 153380378) has the molecular formula C26H20F3NO3 and a molecular weight of 451.44 g/mol. Its IUPAC name is 2-[4-(4-propoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-[4-(4-propoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 153380378 |
| Molecular Formula | C26H20F3NO3 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[4-(4-propoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | CCCOc1ccc(-c2ccc(-c3cc(C(=O)O)c4cc(C(F)(F)F)ccc4n3)cc2)cc1 |
| InChI | InChI=1S/C26H20F3NO3/c1-2-13-33-20-10-7-17(8-11-20)16-3-5-18(6-4-16)24-15-22(25(31)32)21-14-19(26(27,28)29)9-12-23(21)30-24/h3-12,14-15H,2,13H2,1H3,(H,31,32) |
| InChIKey | HZKIDGKHYREVNV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |