C20H17BrKNO3 — CID 23711749
potassium 6-bromo-2-(4-butoxyphenyl)quinoline-4-carboxylate (PubChem CID 23711749) has the molecular formula C20H17BrKNO3 and a molecular weight of 438.36 g/mol. Its IUPAC name is potassium 6-bromo-2-(4-butoxyphenyl)quinoline-4-carboxylate.
| Compound Name | potassium 6-bromo-2-(4-butoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23711749 |
| Molecular Formula | C20H17BrKNO3 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | potassium 6-bromo-2-(4-butoxyphenyl)quinoline-4-carboxylate |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)[O-])c3cc(Br)ccc3n2)cc1.[K+] |
| InChI | InChI=1S/C20H18BrNO3.K/c1-2-3-10-25-15-7-4-13(5-8-15)19-12-17(20(23)24)16-11-14(21)6-9-18(16)22-19;/h4-9,11-12H,2-3,10H2,1H3,(H,23,24);/q;+1/p-1 |
| InChIKey | MJLFTSHMRYTOGR-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|