C13H14F3N3O2 — CID 139222854
2-(diethylamino)-7-(trifluoromethoxy)-3H-quinazolin-4-one (PubChem CID 139222854) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 2-(diethylamino)-7-(trifluoromethoxy)-3H-quinazolin-4-one.
| Compound Name | 2-(diethylamino)-7-(trifluoromethoxy)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 139222854 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(diethylamino)-7-(trifluoromethoxy)-3H-quinazolin-4-one |
| SMILES | CCN(CC)c1nc2cc(OC(F)(F)F)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H14F3N3O2/c1-3-19(4-2)12-17-10-7-8(21-13(14,15)16)5-6-9(10)11(20)18-12/h5-7H,3-4H2,1-2H3,(H,17,18,20) |
| InChIKey | DAJYMWNDKYNVRR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |