C23H19F2N3O2 — CID 135729616
2-[[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]methyl]-3H-quinazolin-4-one (PubChem CID 135729616) has the molecular formula C23H19F2N3O2 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-[[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135729616 |
| Molecular Formula | C23H19F2N3O2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[[[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]amino]methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CN[C@@H](c2ccccc2)c2ccc(OC(F)F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H19F2N3O2/c24-23(25)30-17-12-10-16(11-13-17)21(15-6-2-1-3-7-15)26-14-20-27-19-9-5-4-8-18(19)22(29)28-20/h1-13,21,23,26H,14H2,(H,27,28,29)/t21-/m0/s1 |
| InChIKey | DGPWVWADNLKIDZ-NRFANRHFSA-N |
| XLogP | 4.40 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |