C15H12F2N4O2 — CID 137262894
2-[[5-(difluoromethoxy)-2-pyridinyl]methylamino]-3H-quinazolin-4-one (PubChem CID 137262894) has the molecular formula C15H12F2N4O2 and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-[[5-(difluoromethoxy)-2-pyridinyl]methylamino]-3H-quinazolin-4-one.
| Compound Name | 2-[[5-(difluoromethoxy)-2-pyridinyl]methylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137262894 |
| Molecular Formula | C15H12F2N4O2 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 2-[[5-(difluoromethoxy)-2-pyridinyl]methylamino]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(NCc2ccc(OC(F)F)cn2)nc2ccccc12 |
| InChI | InChI=1S/C15H12F2N4O2/c16-14(17)23-10-6-5-9(18-8-10)7-19-15-20-12-4-2-1-3-11(12)13(22)21-15/h1-6,8,14H,7H2,(H2,19,20,21,22) |
| InChIKey | PSXJDKGYFQTCAW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |