C17H17N3O3 — CID 136748011
2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3H-quinazolin-4-one (PubChem CID 136748011) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3H-quinazolin-4-one.
| Compound Name | 2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 136748011 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(NC[C@H](O)COc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C17H17N3O3/c21-12(11-23-13-6-2-1-3-7-13)10-18-17-19-15-9-5-4-8-14(15)16(22)20-17/h1-9,12,21H,10-11H2,(H2,18,19,20,22)/t12-/m0/s1 |
| InChIKey | XXUWZXODQFWAPK-LBPRGKRZSA-N |
| XLogP | 1.77 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |