C19H20FN3O3 — CID 135952256
2-[[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methylamino]methyl]-3H-quinazolin-4-one (PubChem CID 135952256) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methylamino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methylamino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135952256 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[[[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-methylamino]methyl]-3H-quinazolin-4-one |
| SMILES | CN(Cc1nc2ccccc2c(=O)[nH]1)C[C@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O3/c1-23(10-14(24)12-26-15-8-6-13(20)7-9-15)11-18-21-17-5-3-2-4-16(17)19(25)22-18/h2-9,14,24H,10-12H2,1H3,(H,21,22,25)/t14-/m0/s1 |
| InChIKey | AHVJEDIVWRHCEU-AWEZNQCLSA-N |
| XLogP | 1.93 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |