C19H20N4O3 — CID 135836433
N-(4-methoxyphenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide (PubChem CID 135836433) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 135836433 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)Cc2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H20N4O3/c1-23(12-18(24)20-13-7-9-14(26-2)10-8-13)11-17-21-16-6-4-3-5-15(16)19(25)22-17/h3-10H,11-12H2,1-2H3,(H,20,24)(H,21,22,25) |
| InChIKey | REGNXFSDWIQFDE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |