C16H13Cl2N3O2 — CID 137258168
2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3H-quinazolin-4-one (PubChem CID 137258168) has the molecular formula C16H13Cl2N3O2 and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3H-quinazolin-4-one.
| Compound Name | 2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137258168 |
| Molecular Formula | C16H13Cl2N3O2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-[[2-(3,5-dichlorophenyl)-2-hydroxyethyl]amino]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(NCC(O)c2cc(Cl)cc(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C16H13Cl2N3O2/c17-10-5-9(6-11(18)7-10)14(22)8-19-16-20-13-4-2-1-3-12(13)15(23)21-16/h1-7,14,22H,8H2,(H2,19,20,21,23) |
| InChIKey | DJWOIOZRYWOYMS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |