C19H14FN3O2 — CID 166201526
2-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3H-quinazolin-4-one (PubChem CID 166201526) has the molecular formula C19H14FN3O2 and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3H-quinazolin-4-one.
| Compound Name | 2-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 166201526 |
| Molecular Formula | C19H14FN3O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)furan-2-yl]methylamino]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(NCc2ccc(-c3ccccc3F)o2)nc2ccccc12 |
| InChI | InChI=1S/C19H14FN3O2/c20-15-7-3-1-5-13(15)17-10-9-12(25-17)11-21-19-22-16-8-4-2-6-14(16)18(24)23-19/h1-10H,11H2,(H2,21,22,23,24) |
| InChIKey | RUDYRLWZNCFEQL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |