C13H12FN5O — CID 4726884
N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-1-methyltetrazol-5-amine (PubChem CID 4726884) has the molecular formula C13H12FN5O and a molecular weight of 273.27 g/mol. Its IUPAC name is N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 4726884 |
| Molecular Formula | C13H12FN5O |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-1-methyltetrazol-5-amine |
| SMILES | Cn1nnnc1NCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C13H12FN5O/c1-19-13(16-17-18-19)15-8-9-6-7-12(20-9)10-4-2-3-5-11(10)14/h2-7H,8H2,1H3,(H,15,16,18) |
| InChIKey | JOIKOIZLXQYMJS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |