C10H12FN5 — CID 63151902
N-[2-(2-fluorophenyl)ethyl]-1-methyltetrazol-5-amine (PubChem CID 63151902) has the molecular formula C10H12FN5 and a molecular weight of 221.24 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 63151902 |
| Molecular Formula | C10H12FN5 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-1-methyltetrazol-5-amine |
| SMILES | Cn1nnnc1NCCc1ccccc1F |
| InChI | InChI=1S/C10H12FN5/c1-16-10(13-14-15-16)12-7-6-8-4-2-3-5-9(8)11/h2-5H,6-7H2,1H3,(H,12,13,15) |
| InChIKey | GOFODDWAQDMDMY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |