C9H9ClFN5 — CID 1251687
N-[(2-chloro-6-fluorophenyl)methyl]-1-methyltetrazol-5-amine (PubChem CID 1251687) has the molecular formula C9H9ClFN5 and a molecular weight of 241.66 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-1-methyltetrazol-5-amine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 1251687 |
| Molecular Formula | C9H9ClFN5 |
| Molecular Weight | 241.66 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-1-methyltetrazol-5-amine |
| SMILES | Cn1nnnc1NCc1c(F)cccc1Cl |
| InChI | InChI=1S/C9H9ClFN5/c1-16-9(13-14-15-16)12-5-6-7(10)3-2-4-8(6)11/h2-4H,5H2,1H3,(H,12,13,15) |
| InChIKey | VSDCIULKKGWKEH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.66 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |