C10H9ClFN3 — CID 43539940
N-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-4-amine (PubChem CID 43539940) has the molecular formula C10H9ClFN3 and a molecular weight of 225.65 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-4-amine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43539940 |
| Molecular Formula | C10H9ClFN3 |
| Molecular Weight | 225.65 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-4-amine |
| SMILES | Fc1cccc(Cl)c1CNc1cn[nH]c1 |
| InChI | InChI=1S/C10H9ClFN3/c11-9-2-1-3-10(12)8(9)6-13-7-4-14-15-5-7/h1-5,13H,6H2,(H,14,15) |
| InChIKey | RXXMTQKUPQHMMA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |