C14H11Cl2FN6 — CID 141388777
4-N-[(3,6-dichloro-2-fluorophenyl)methyl]-2-N-(1H-pyrazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 141388777) has the molecular formula C14H11Cl2FN6 and a molecular weight of 353.19 g/mol. Its IUPAC name is 4-N-[(3,6-dichloro-2-fluorophenyl)methyl]-2-N-(1H-pyrazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3,6-dichloro-2-fluorophenyl)methyl]-2-N-(1H-pyrazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141388777 |
| Molecular Formula | C14H11Cl2FN6 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 4-N-[(3,6-dichloro-2-fluorophenyl)methyl]-2-N-(1H-pyrazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | Fc1c(Cl)ccc(Cl)c1CNc1ccnc(Nc2cn[nH]c2)n1 |
| InChI | InChI=1S/C14H11Cl2FN6/c15-10-1-2-11(16)13(17)9(10)7-19-12-3-4-18-14(23-12)22-8-5-20-21-6-8/h1-6H,7H2,(H,20,21)(H2,18,19,22,23) |
| InChIKey | OBZLRCRSOJFSSK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|