C15H13F3N6 — CID 141388759
5-methyl-2-N-(1H-pyrazol-4-yl)-4-N-[(2,3,6-trifluorophenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 141388759) has the molecular formula C15H13F3N6 and a molecular weight of 334.31 g/mol. Its IUPAC name is 5-methyl-2-N-(1H-pyrazol-4-yl)-4-N-[(2,3,6-trifluorophenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-2-N-(1H-pyrazol-4-yl)-4-N-[(2,3,6-trifluorophenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141388759 |
| Molecular Formula | C15H13F3N6 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5-methyl-2-N-(1H-pyrazol-4-yl)-4-N-[(2,3,6-trifluorophenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2cn[nH]c2)nc1NCc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C15H13F3N6/c1-8-4-20-15(23-9-5-21-22-6-9)24-14(8)19-7-10-11(16)2-3-12(17)13(10)18/h2-6H,7H2,1H3,(H,21,22)(H2,19,20,23,24) |
| InChIKey | RCJKSZOLQUYSDZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|