C17H16F3N7O — CID 165112300
2-[(1-ethylpyrazol-4-yl)amino]-4-[(2,3,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 165112300) has the molecular formula C17H16F3N7O and a molecular weight of 391.36 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)amino]-4-[(2,3,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-[(2,3,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 165112300 |
| Molecular Formula | C17H16F3N7O |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-[(2,3,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | CCn1cc(Nc2ncc(C(N)=O)c(NCc3c(F)ccc(F)c3F)n2)cn1 |
| InChI | InChI=1S/C17H16F3N7O/c1-2-27-8-9(5-24-27)25-17-23-7-11(15(21)28)16(26-17)22-6-10-12(18)3-4-13(19)14(10)20/h3-5,7-8H,2,6H2,1H3,(H2,21,28)(H2,22,23,25,26) |
| InChIKey | FMQJJFMKSBZQNO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|