C19H20N8O — CID 165112332
2-[(1-ethylpyrazol-4-yl)amino]-4-(1H-indol-3-ylmethylamino)pyrimidine-5-carboxamide (PubChem CID 165112332) has the molecular formula C19H20N8O and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)amino]-4-(1H-indol-3-ylmethylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-(1H-indol-3-ylmethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 165112332 |
| Molecular Formula | C19H20N8O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-(1H-indol-3-ylmethylamino)pyrimidine-5-carboxamide |
| SMILES | CCn1cc(Nc2ncc(C(N)=O)c(NCc3c[nH]c4ccccc34)n2)cn1 |
| InChI | InChI=1S/C19H20N8O/c1-2-27-11-13(9-24-27)25-19-23-10-15(17(20)28)18(26-19)22-8-12-7-21-16-6-4-3-5-14(12)16/h3-7,9-11,21H,2,8H2,1H3,(H2,20,28)(H2,22,23,25,26) |
| InChIKey | JMVHTOGNSAVURB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |