C13H19N7O2 — CID 165112238
2-[(1-ethylpyrazol-4-yl)amino]-4-(2-methoxyethylamino)pyrimidine-5-carboxamide (PubChem CID 165112238) has the molecular formula C13H19N7O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)amino]-4-(2-methoxyethylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-(2-methoxyethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 165112238 |
| Molecular Formula | C13H19N7O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)amino]-4-(2-methoxyethylamino)pyrimidine-5-carboxamide |
| SMILES | CCn1cc(Nc2ncc(C(N)=O)c(NCCOC)n2)cn1 |
| InChI | InChI=1S/C13H19N7O2/c1-3-20-8-9(6-17-20)18-13-16-7-10(11(14)21)12(19-13)15-4-5-22-2/h6-8H,3-5H2,1-2H3,(H2,14,21)(H2,15,16,18,19) |
| InChIKey | WTKRSPTYZNOJGY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|