C18H20ClN7O — CID 165112360
4-(2-chloro-6-methylanilino)-2-[(1-propylpyrazol-4-yl)amino]pyrimidine-5-carboxamide (PubChem CID 165112360) has the molecular formula C18H20ClN7O and a molecular weight of 385.86 g/mol. Its IUPAC name is 4-(2-chloro-6-methylanilino)-2-[(1-propylpyrazol-4-yl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-(2-chloro-6-methylanilino)-2-[(1-propylpyrazol-4-yl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 165112360 |
| Molecular Formula | C18H20ClN7O |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-(2-chloro-6-methylanilino)-2-[(1-propylpyrazol-4-yl)amino]pyrimidine-5-carboxamide |
| SMILES | CCCn1cc(Nc2ncc(C(N)=O)c(Nc3c(C)cccc3Cl)n2)cn1 |
| InChI | InChI=1S/C18H20ClN7O/c1-3-7-26-10-12(8-22-26)23-18-21-9-13(16(20)27)17(25-18)24-15-11(2)5-4-6-14(15)19/h4-6,8-10H,3,7H2,1-2H3,(H2,20,27)(H2,21,23,24,25) |
| InChIKey | CROCQIIGCRCFHS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |