C23H25ClN8O3 — CID 155126911
4-(2-chloro-6-methoxyanilino)-2-[[1-(1-prop-2-enoylpiperidin-3-yl)pyrazol-4-yl]amino]pyrimidine-5-carboxamide (PubChem CID 155126911) has the molecular formula C23H25ClN8O3 and a molecular weight of 496.96 g/mol. Its IUPAC name is 4-(2-chloro-6-methoxyanilino)-2-[[1-(1-prop-2-enoylpiperidin-3-yl)pyrazol-4-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-(2-chloro-6-methoxyanilino)-2-[[1-(1-prop-2-enoylpiperidin-3-yl)pyrazol-4-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155126911 |
| Molecular Formula | C23H25ClN8O3 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-(2-chloro-6-methoxyanilino)-2-[[1-(1-prop-2-enoylpiperidin-3-yl)pyrazol-4-yl]amino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)N1CCCC(n2cc(Nc3ncc(C(N)=O)c(Nc4c(Cl)cccc4OC)n3)cn2)C1 |
| InChI | InChI=1S/C23H25ClN8O3/c1-3-19(33)31-9-5-6-15(13-31)32-12-14(10-27-32)28-23-26-11-16(21(25)34)22(30-23)29-20-17(24)7-4-8-18(20)35-2/h3-4,7-8,10-12,15H,1,5-6,9,13H2,2H3,(H2,25,34)(H2,26,28,29,30) |
| InChIKey | QUGZNUJEJNUWHD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 140.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|