C25H30N8O3 — CID 155139098
4-(2-ethyl-6-methoxyanilino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidine-5-carboxamide (PubChem CID 155139098) has the molecular formula C25H30N8O3 and a molecular weight of 490.57 g/mol. Its IUPAC name is 4-(2-ethyl-6-methoxyanilino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-(2-ethyl-6-methoxyanilino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155139098 |
| Molecular Formula | C25H30N8O3 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 4-(2-ethyl-6-methoxyanilino)-2-[[1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazol-4-yl]amino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](n2cc(Nc3ncc(C(N)=O)c(Nc4c(CC)cccc4OC)n3)cn2)C1 |
| InChI | InChI=1S/C25H30N8O3/c1-4-16-8-6-10-20(36-3)22(16)30-24-19(23(26)35)13-27-25(31-24)29-17-12-28-33(14-17)18-9-7-11-32(15-18)21(34)5-2/h5-6,8,10,12-14,18H,2,4,7,9,11,15H2,1,3H3,(H2,26,35)(H2,27,29,30,31)/t18-/m1/s1 |
| InChIKey | QYEOYKYAACASAJ-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 140.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|