C10H15ClN4O3 — CID 154628246
2-chloro-4-[2-(2-methoxyethoxy)ethylamino]pyrimidine-5-carboxamide (PubChem CID 154628246) has the molecular formula C10H15ClN4O3 and a molecular weight of 274.71 g/mol. Its IUPAC name is 2-chloro-4-[2-(2-methoxyethoxy)ethylamino]pyrimidine-5-carboxamide.
| Compound Name | 2-chloro-4-[2-(2-methoxyethoxy)ethylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 154628246 |
| Molecular Formula | C10H15ClN4O3 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-chloro-4-[2-(2-methoxyethoxy)ethylamino]pyrimidine-5-carboxamide |
| SMILES | COCCOCCNc1nc(Cl)ncc1C(N)=O |
| InChI | InChI=1S/C10H15ClN4O3/c1-17-4-5-18-3-2-13-9-7(8(12)16)6-14-10(11)15-9/h6H,2-5H2,1H3,(H2,12,16)(H,13,14,15) |
| InChIKey | SYECUKDRQKEBAO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|