C9H11ClN4O — CID 138495192
4-(but-3-enylamino)-2-chloropyrimidine-5-carboxamide (PubChem CID 138495192) has the molecular formula C9H11ClN4O and a molecular weight of 226.67 g/mol. Its IUPAC name is 4-(but-3-enylamino)-2-chloropyrimidine-5-carboxamide.
| Compound Name | 4-(but-3-enylamino)-2-chloropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 138495192 |
| Molecular Formula | C9H11ClN4O |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-(but-3-enylamino)-2-chloropyrimidine-5-carboxamide |
| SMILES | C=CCCNc1nc(Cl)ncc1C(N)=O |
| InChI | InChI=1S/C9H11ClN4O/c1-2-3-4-12-8-6(7(11)15)5-13-9(10)14-8/h2,5H,1,3-4H2,(H2,11,15)(H,12,13,14) |
| InChIKey | YIKWOEAGQUSNRI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|