C18H26N6O — CID 160771759
2-[(1-tert-butylpyrazol-4-yl)methyl]-4-(pent-4-enylamino)pyrimidine-5-carboxamide (PubChem CID 160771759) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-[(1-tert-butylpyrazol-4-yl)methyl]-4-(pent-4-enylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-[(1-tert-butylpyrazol-4-yl)methyl]-4-(pent-4-enylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 160771759 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-[(1-tert-butylpyrazol-4-yl)methyl]-4-(pent-4-enylamino)pyrimidine-5-carboxamide |
| SMILES | C=CCCCNc1nc(Cc2cnn(C(C)(C)C)c2)ncc1C(N)=O |
| InChI | InChI=1S/C18H26N6O/c1-5-6-7-8-20-17-14(16(19)25)11-21-15(23-17)9-13-10-22-24(12-13)18(2,3)4/h5,10-12H,1,6-9H2,2-4H3,(H2,19,25)(H,20,21,23) |
| InChIKey | RZKIAIKIMUYOCK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|