C10H15N4O3S- — CID 138692561
[4-(tert-butylamino)-5-carbamoylpyrimidin-2-yl]methanesulfinate (PubChem CID 138692561) has the molecular formula C10H15N4O3S- and a molecular weight of 271.32 g/mol. Its IUPAC name is [4-(tert-butylamino)-5-carbamoylpyrimidin-2-yl]methanesulfinate.
| Compound Name | [4-(tert-butylamino)-5-carbamoylpyrimidin-2-yl]methanesulfinate |
|---|---|
| PubChem CID | 138692561 |
| Molecular Formula | C10H15N4O3S- |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [4-(tert-butylamino)-5-carbamoylpyrimidin-2-yl]methanesulfinate |
| SMILES | CC(C)(C)Nc1nc(CS(=O)[O-])ncc1C(N)=O |
| InChI | InChI=1S/C10H16N4O3S/c1-10(2,3)14-9-6(8(11)15)4-12-7(13-9)5-18(16)17/h4H,5H2,1-3H3,(H2,11,15)(H,16,17)(H,12,13,14)/p-1 |
| InChIKey | QEUTZRQBNZKHPH-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|