C11H16N4O4S — CID 138692577
[5-carbamoyl-4-[[(1S,2S)-2-hydroxycyclopentyl]amino]pyrimidin-2-yl]methanesulfinic acid (PubChem CID 138692577) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is [5-carbamoyl-4-[[(1S,2S)-2-hydroxycyclopentyl]amino]pyrimidin-2-yl]methanesulfinic acid.
| Compound Name | [5-carbamoyl-4-[[(1S,2S)-2-hydroxycyclopentyl]amino]pyrimidin-2-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 138692577 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [5-carbamoyl-4-[[(1S,2S)-2-hydroxycyclopentyl]amino]pyrimidin-2-yl]methanesulfinic acid |
| SMILES | NC(=O)c1cnc(CS(=O)O)nc1N[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C11H16N4O4S/c12-10(17)6-4-13-9(5-20(18)19)15-11(6)14-7-2-1-3-8(7)16/h4,7-8,16H,1-3,5H2,(H2,12,17)(H,18,19)(H,13,14,15)/t7-,8-/m0/s1 |
| InChIKey | RLXYFQQDIUVCMD-YUMQZZPRSA-N |
| XLogP | -0.38 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|