About 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide
4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide (PubChem CID 150669993) has the molecular formula C17H21ClN4O3
and a molecular weight of 364.83 g/mol. Its IUPAC name is 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide |
| PubChem CID | 150669993 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide |
| SMILES | CC(C)(O)c1cc(Nc2nc(Cl)ncc2C(N)=O)cc(C(C)(C)O)c1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-16(2,24)9-5-10(17(3,4)25)7-11(6-9)21-14-12(13(19)23)8-20-15(18)22-14/h5-8,24-25H,1-4H3,(H2,19,23)(H,20,21,22) |
| InChIKey | JFRIBJOAAUNXBY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide?
The IUPAC name of 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide (CID 150669993) is 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide.
What is the SMILES notation for 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide?
The canonical SMILES for 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide is CC(C)(O)c1cc(Nc2nc(Cl)ncc2C(N)=O)cc(C(C)(C)O)c1.
What is the InChIKey of 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide?
The InChIKey is JFRIBJOAAUNXBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN4O3/c1-16(2,24)9-5-10(17(3,4)25)7-11(6-9)21-14-12(13(19)23)8-20-15(18)22-14/h5-8,24-25H,1-4H3,(H2,19,23)(H,20,21,22).
What are the key properties of 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide?
4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide has a molecular weight of 364.83 g/mol, XLogP of 2.43, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(2-hydroxypropan-2-yl)anilino]-2-chloropyrimidine-5-carboxamide is sourced from PubChem (CID 150669993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).