About 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide
2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide (PubChem CID 106240010) has the molecular formula C8H10Cl2N4O2
and a molecular weight of 265.10 g/mol. Its IUPAC name is 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide.
Molecular Properties
| Compound Name | 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide |
| PubChem CID | 106240010 |
| Molecular Formula | C8H10Cl2N4O2 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C8H10Cl2N4O2/c9-5-3-13-8(10)14-7(5)12-1-2-16-4-6(11)15/h3H,1-2,4H2,(H2,11,15)(H,12,13,14) |
| InChIKey | UKEZGUXYZIEXTE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide?
The IUPAC name of 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide (CID 106240010) is 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide.
What is the SMILES notation for 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide?
The canonical SMILES for 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide is NC(=O)COCCNc1nc(Cl)ncc1Cl.
What is the InChIKey of 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide?
The InChIKey is UKEZGUXYZIEXTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N4O2/c9-5-3-13-8(10)14-7(5)12-1-2-16-4-6(11)15/h3H,1-2,4H2,(H2,11,15)(H,12,13,14).
What are the key properties of 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide?
2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide has a molecular weight of 265.10 g/mol, XLogP of 0.70, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]ethoxy]acetamide is sourced from PubChem (CID 106240010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).